C15H9BrClN3O3 — CID 135613701
3-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 135613701) has the molecular formula C15H9BrClN3O3 and a molecular weight of 394.61 g/mol. Its IUPAC name is 3-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 135613701 |
| Molecular Formula | C15H9BrClN3O3 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 3-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1/N=C/c1cc(Cl)cc(Br)c1O |
| InChI | InChI=1S/C15H9BrClN3O3/c16-11-6-9(17)5-8(13(11)21)7-18-20-14(22)10-3-1-2-4-12(10)19-15(20)23/h1-7,21H,(H,19,23)/b18-7+ |
| InChIKey | KQRWOLZRVQNJNG-CNHKJKLMSA-N |
| XLogP | 2.69 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|