C17H11ClN4O7 — CID 3914786
2-[4-chloro-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetic acid (PubChem CID 3914786) has the molecular formula C17H11ClN4O7 and a molecular weight of 418.75 g/mol. Its IUPAC name is 2-[4-chloro-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetic acid |
|---|---|
| PubChem CID | 3914786 |
| Molecular Formula | C17H11ClN4O7 |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 2-[4-chloro-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11ClN4O7/c18-10-5-9(15(29-8-14(23)24)13(6-10)22(27)28)7-19-21-16(25)11-3-1-2-4-12(11)20-17(21)26/h1-7H,8H2,(H,20,26)(H,23,24) |
| InChIKey | FYOPBJHPCPHXMP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|