C23H15ClN4O7 — CID 3330770
3-[[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 3330770) has the molecular formula C23H15ClN4O7 and a molecular weight of 494.85 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3330770 |
| Molecular Formula | C23H15ClN4O7 |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 3-[[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2c(Cl)cc(C=Nn3c(=O)[nH]c4ccccc4c3=O)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H15ClN4O7/c24-17-9-14(11-25-27-21(29)16-6-1-2-7-18(16)26-23(27)32)10-19(28(33)34)20(17)35-12-13-4-3-5-15(8-13)22(30)31/h1-11H,12H2,(H,26,32)(H,30,31) |
| InChIKey | CAQJXTFZMJZNJA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|