C22H14Cl2N4O5 — CID 3957554
3-[[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 3957554) has the molecular formula C22H14Cl2N4O5 and a molecular weight of 485.28 g/mol. Its IUPAC name is 3-[[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3957554 |
| Molecular Formula | C22H14Cl2N4O5 |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 3-[[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1N=Cc1cc(Cl)c(OCc2cccc([N+](=O)[O-])c2)c(Cl)c1 |
| InChI | InChI=1S/C22H14Cl2N4O5/c23-17-9-14(11-25-27-21(29)16-6-1-2-7-19(16)26-22(27)30)10-18(24)20(17)33-12-13-4-3-5-15(8-13)28(31)32/h1-11H,12H2,(H,26,30) |
| InChIKey | RCVAKFUGYYNCJQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|