C24H19BrN4O6 — CID 126357420
3-[[3-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 126357420) has the molecular formula C24H19BrN4O6 and a molecular weight of 539.34 g/mol. Its IUPAC name is 3-[[3-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 126357420 |
| Molecular Formula | C24H19BrN4O6 |
| Molecular Weight | 539.34 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | 3-[[3-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(Br)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19BrN4O6/c1-2-34-21-12-16(13-26-28-23(30)18-8-3-4-9-20(18)27-24(28)31)11-19(25)22(21)35-14-15-6-5-7-17(10-15)29(32)33/h3-13H,2,14H2,1H3,(H,27,31) |
| InChIKey | YMJMQRXRXSYGSF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|