C17H14N4O6 — CID 135716703
3-[(E)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 135716703) has the molecular formula C17H14N4O6 and a molecular weight of 370.32 g/mol. Its IUPAC name is 3-[(E)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(E)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 135716703 |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-[(E)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cc(/C=N/n2c(=O)[nH]c3ccccc3c2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H14N4O6/c1-2-27-14-8-10(7-13(15(14)22)21(25)26)9-18-20-16(23)11-5-3-4-6-12(11)19-17(20)24/h3-9,22H,2H2,1H3,(H,19,24)/b18-9+ |
| InChIKey | MRRGPQYRCJRART-GIJQJNRQSA-N |
| XLogP | 1.58 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|