C23H17FN4O6 — CID 5213660
3-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 5213660) has the molecular formula C23H17FN4O6 and a molecular weight of 464.41 g/mol. Its IUPAC name is 3-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 5213660 |
| Molecular Formula | C23H17FN4O6 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | COc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FN4O6/c1-33-20-11-15(12-25-27-22(29)17-4-2-3-5-18(17)26-23(27)30)10-19(28(31)32)21(20)34-13-14-6-8-16(24)9-7-14/h2-12H,13H2,1H3,(H,26,30) |
| InChIKey | HOKRVBWWGGFFRM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|