C24H20ClN3O5 — CID 3654828
3-[[4-[(4-chlorophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 3654828) has the molecular formula C24H20ClN3O5 and a molecular weight of 465.89 g/mol. Its IUPAC name is 3-[[4-[(4-chlorophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[4-[(4-chlorophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3654828 |
| Molecular Formula | C24H20ClN3O5 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 3-[[4-[(4-chlorophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | COc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(OC)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20ClN3O5/c1-31-20-11-16(12-21(32-2)22(20)33-14-15-7-9-17(25)10-8-15)13-26-28-23(29)18-5-3-4-6-19(18)27-24(28)30/h3-13H,14H2,1-2H3,(H,27,30) |
| InChIKey | UNYFEGINJRPBGH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|