C24H19BrClN3O4 — CID 126367803
3-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 126367803) has the molecular formula C24H19BrClN3O4 and a molecular weight of 528.79 g/mol. Its IUPAC name is 3-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 126367803 |
| Molecular Formula | C24H19BrClN3O4 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | 3-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)c(Br)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19BrClN3O4/c1-2-32-21-11-16(19(25)12-22(21)33-14-15-7-9-17(26)10-8-15)13-27-29-23(30)18-5-3-4-6-20(18)28-24(29)31/h3-13H,2,14H2,1H3,(H,28,31) |
| InChIKey | SPMKBTDGTFBJDO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|