C23H16ClN3O5 — CID 3873184
3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-chlorophenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 3873184) has the molecular formula C23H16ClN3O5 and a molecular weight of 449.85 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-chlorophenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-chlorophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3873184 |
| Molecular Formula | C23H16ClN3O5 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-chlorophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1N=Cc1cc(Cl)ccc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H16ClN3O5/c24-16-6-8-19(30-12-14-5-7-20-21(9-14)32-13-31-20)15(10-16)11-25-27-22(28)17-3-1-2-4-18(17)26-23(27)29/h1-11H,12-13H2,(H,26,29) |
| InChIKey | YWAFRMIIFSLLPS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|