C24H20Cl2N4O3 — CID 4558111
3-[[2-[(2,4-dichlorophenyl)methoxy]-4-(dimethylamino)phenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 4558111) has the molecular formula C24H20Cl2N4O3 and a molecular weight of 483.36 g/mol. Its IUPAC name is 3-[[2-[(2,4-dichlorophenyl)methoxy]-4-(dimethylamino)phenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[2-[(2,4-dichlorophenyl)methoxy]-4-(dimethylamino)phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 4558111 |
| Molecular Formula | C24H20Cl2N4O3 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 3-[[2-[(2,4-dichlorophenyl)methoxy]-4-(dimethylamino)phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | CN(C)c1ccc(C=Nn2c(=O)[nH]c3ccccc3c2=O)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C24H20Cl2N4O3/c1-29(2)18-10-8-15(22(12-18)33-14-16-7-9-17(25)11-20(16)26)13-27-30-23(31)19-5-3-4-6-21(19)28-24(30)32/h3-13H,14H2,1-2H3,(H,28,32) |
| InChIKey | YMELMFCUYAYSRJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|