C17H15N3O4 — CID 4302099
3-[(2,4-dimethoxyphenyl)methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 4302099) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 3-[(2,4-dimethoxyphenyl)methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(2,4-dimethoxyphenyl)methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 4302099 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3-[(2,4-dimethoxyphenyl)methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(C=Nn2c(=O)[nH]c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C17H15N3O4/c1-23-12-8-7-11(15(9-12)24-2)10-18-20-16(21)13-5-3-4-6-14(13)19-17(20)22/h3-10H,1-2H3,(H,19,22) |
| InChIKey | QAJHBUIDLPRRSA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|