C20H19N3O7 — CID 4224449
methyl 2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]acetate (PubChem CID 4224449) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is methyl 2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 4224449 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | methyl 2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(OC)cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C20H19N3O7/c1-27-15-8-12(9-16(28-2)18(15)30-11-17(24)29-3)10-21-23-19(25)13-6-4-5-7-14(13)22-20(23)26/h4-10H,11H2,1-3H3,(H,22,26) |
| InChIKey | ZGPDJTWMDFLGRW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|