C22H21N3O6 — CID 126370748
(2R)-2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]propanoic acid (PubChem CID 126370748) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is (2R)-2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126370748 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (2R)-2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]propanoic acid |
| SMILES | C=CCc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(OC)c1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C22H21N3O6/c1-4-7-15-10-14(11-18(30-3)19(15)31-13(2)21(27)28)12-23-25-20(26)16-8-5-6-9-17(16)24-22(25)29/h4-6,8-13H,1,7H2,2-3H3,(H,24,29)(H,27,28)/t13-/m1/s1 |
| InChIKey | YQIHSAOEUWFHIM-CYBMUJFWSA-N |
| XLogP | 2.16 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|