C24H19N5O6 — CID 4545995
3-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 4545995) has the molecular formula C24H19N5O6 and a molecular weight of 473.45 g/mol. Its IUPAC name is 3-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 4545995 |
| Molecular Formula | C24H19N5O6 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 3-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | C=CCc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(OC)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C24H19N5O6/c1-3-6-16-11-15(13-26-28-23(30)18-7-4-5-8-19(18)27-24(28)31)12-20(34-2)22(16)35-21-10-9-17(14-25-21)29(32)33/h3-5,7-14H,1,6H2,2H3,(H,27,31) |
| InChIKey | WWBWEWCMBYTCTH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 141.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|