C27H23N3O6 — CID 4019397
3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 4019397) has the molecular formula C27H23N3O6 and a molecular weight of 485.50 g/mol. Its IUPAC name is 3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 4019397 |
| Molecular Formula | C27H23N3O6 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(OC)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C27H23N3O6/c1-3-7-19-13-18(15-28-30-25(31)21-10-4-5-11-22(21)29-27(30)34)14-23(35-2)24(19)36-16-17-8-6-9-20(12-17)26(32)33/h3-6,8-15H,1,7,16H2,2H3,(H,29,34)(H,32,33) |
| InChIKey | SIRVNYCUUXFLLI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|