C23H17N3O5 — CID 3892535
3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 3892535) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is 3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3892535 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 3-[[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccc(C=Nn3c(=O)[nH]c4ccccc4c3=O)cc2)c1 |
| InChI | InChI=1S/C23H17N3O5/c27-21-19-6-1-2-7-20(19)25-23(30)26(21)24-13-15-8-10-18(11-9-15)31-14-16-4-3-5-17(12-16)22(28)29/h1-13H,14H2,(H,25,30)(H,28,29) |
| InChIKey | VLHAWLTZHSYRTE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|