C22H14Cl2FN3O3 — CID 4519584
3-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 4519584) has the molecular formula C22H14Cl2FN3O3 and a molecular weight of 458.28 g/mol. Its IUPAC name is 3-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 4519584 |
| Molecular Formula | C22H14Cl2FN3O3 |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 3-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1N=Cc1cc(Cl)c(OCc2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C22H14Cl2FN3O3/c23-17-9-14(10-18(24)20(17)31-12-13-5-7-15(25)8-6-13)11-26-28-21(29)16-3-1-2-4-19(16)27-22(28)30/h1-11H,12H2,(H,27,30) |
| InChIKey | RHJGXIKAXJZTCD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|