C18H13Cl2N3O5 — CID 126349721
(2R)-2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoic acid (PubChem CID 126349721) has the molecular formula C18H13Cl2N3O5 and a molecular weight of 422.22 g/mol. Its IUPAC name is (2R)-2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126349721 |
| Molecular Formula | C18H13Cl2N3O5 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | (2R)-2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1c(Cl)cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc1Cl)C(=O)O |
| InChI | InChI=1S/C18H13Cl2N3O5/c1-9(17(25)26)28-15-12(19)6-10(7-13(15)20)8-21-23-16(24)11-4-2-3-5-14(11)22-18(23)27/h2-9H,1H3,(H,22,27)(H,25,26)/t9-/m1/s1 |
| InChIKey | HXSLGBVZZMRCHM-SECBINFHSA-N |
| XLogP | 2.73 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|