C19H15ClN4O7 — CID 126361967
methyl (2R)-2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoate (PubChem CID 126361967) has the molecular formula C19H15ClN4O7 and a molecular weight of 446.80 g/mol. Its IUPAC name is methyl (2R)-2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoate.
| Compound Name | methyl (2R)-2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126361967 |
| Molecular Formula | C19H15ClN4O7 |
| Molecular Weight | 446.80 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | methyl (2R)-2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1c(Cl)cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15ClN4O7/c1-10(18(26)30-2)31-16-13(20)7-11(8-15(16)24(28)29)9-21-23-17(25)12-5-3-4-6-14(12)22-19(23)27/h3-10H,1-2H3,(H,22,27)/t10-/m1/s1 |
| InChIKey | HCNOSFBBXILMJY-SNVBAGLBSA-N |
| XLogP | 2.07 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.80 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|