C21H20N4O8 — CID 126360148
methyl (2S)-2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]propanoate (PubChem CID 126360148) has the molecular formula C21H20N4O8 and a molecular weight of 456.41 g/mol. Its IUPAC name is methyl (2S)-2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]propanoate.
| Compound Name | methyl (2S)-2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126360148 |
| Molecular Formula | C21H20N4O8 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | methyl (2S)-2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]propanoate |
| SMILES | CCOc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc([N+](=O)[O-])c1O[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C21H20N4O8/c1-4-32-17-10-13(9-16(25(29)30)18(17)33-12(2)20(27)31-3)11-22-24-19(26)14-7-5-6-8-15(14)23-21(24)28/h5-12H,4H2,1-3H3,(H,23,28)/t12-/m0/s1 |
| InChIKey | BERGVCMXOBFWKA-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|