C20H17Cl2N3O5 — CID 126350530
ethyl (2S)-2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoate (PubChem CID 126350530) has the molecular formula C20H17Cl2N3O5 and a molecular weight of 450.28 g/mol. Its IUPAC name is ethyl (2S)-2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoate.
| Compound Name | ethyl (2S)-2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 126350530 |
| Molecular Formula | C20H17Cl2N3O5 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | ethyl (2S)-2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoate |
| SMILES | CCOC(=O)[C@H](C)Oc1c(Cl)cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C20H17Cl2N3O5/c1-3-29-19(27)11(2)30-17-14(21)8-12(9-15(17)22)10-23-25-18(26)13-6-4-5-7-16(13)24-20(25)28/h4-11H,3H2,1-2H3,(H,24,28)/t11-/m0/s1 |
| InChIKey | HHILFXJGRUISQH-NSHDSACASA-N |
| XLogP | 3.21 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|