C18H14ClN3O5 — CID 126348547
(2S)-2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoic acid (PubChem CID 126348547) has the molecular formula C18H14ClN3O5 and a molecular weight of 387.78 g/mol. Its IUPAC name is (2S)-2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126348547 |
| Molecular Formula | C18H14ClN3O5 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (2S)-2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoic acid |
| SMILES | C[C@H](Oc1ccc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc1Cl)C(=O)O |
| InChI | InChI=1S/C18H14ClN3O5/c1-10(17(24)25)27-15-7-6-11(8-13(15)19)9-20-22-16(23)12-4-2-3-5-14(12)21-18(22)26/h2-10H,1H3,(H,21,26)(H,24,25)/t10-/m0/s1 |
| InChIKey | GRYOLTPVVZYJBR-JTQLQIEISA-N |
| XLogP | 2.08 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|