C23H17ClN4O4 — CID 3944031
2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-phenylacetamide (PubChem CID 3944031) has the molecular formula C23H17ClN4O4 and a molecular weight of 448.87 g/mol. Its IUPAC name is 2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 3944031 |
| Molecular Formula | C23H17ClN4O4 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-[2-chloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc1Cl)Nc1ccccc1 |
| InChI | InChI=1S/C23H17ClN4O4/c24-18-12-15(10-11-20(18)32-14-21(29)26-16-6-2-1-3-7-16)13-25-28-22(30)17-8-4-5-9-19(17)27-23(28)31/h1-13H,14H2,(H,26,29)(H,27,31) |
| InChIKey | DUXOBUUPGBNOIY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|