C27H19ClN4O4 — CID 3986666
N-(4-chlorophenyl)-2-[1-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]naphthalen-2-yl]oxyacetamide (PubChem CID 3986666) has the molecular formula C27H19ClN4O4 and a molecular weight of 498.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[1-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]naphthalen-2-yl]oxyacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[1-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 3986666 |
| Molecular Formula | C27H19ClN4O4 |
| Molecular Weight | 498.93 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | N-(4-chlorophenyl)-2-[1-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]naphthalen-2-yl]oxyacetamide |
| SMILES | O=C(COc1ccc2ccccc2c1C=Nn1c(=O)[nH]c2ccccc2c1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H19ClN4O4/c28-18-10-12-19(13-11-18)30-25(33)16-36-24-14-9-17-5-1-2-6-20(17)22(24)15-29-32-26(34)21-7-3-4-8-23(21)31-27(32)35/h1-15H,16H2,(H,30,33)(H,31,35) |
| InChIKey | ULRWTRMOFUJKMP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|