C24H20N4O4 — CID 4575125
2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 4575125) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4575125 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-[4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C=Nn3c(=O)[nH]c4ccccc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C24H20N4O4/c1-16-6-10-18(11-7-16)26-22(29)15-32-19-12-8-17(9-13-19)14-25-28-23(30)20-4-2-3-5-21(20)27-24(28)31/h2-14H,15H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | KCYIYQOKBVXJBV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|