C24H18BrN5O6 — CID 126360995
2-[4-bromo-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126360995) has the molecular formula C24H18BrN5O6 and a molecular weight of 552.34 g/mol. Its IUPAC name is 2-[4-bromo-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126360995 |
| Molecular Formula | C24H18BrN5O6 |
| Molecular Weight | 552.34 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | 2-[4-bromo-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(C=Nn3c(=O)[nH]c4ccccc4c3=O)cc(Br)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H18BrN5O6/c1-14-6-8-17(9-7-14)27-21(31)13-36-22-15(10-16(25)11-20(22)30(34)35)12-26-29-23(32)18-4-2-3-5-19(18)28-24(29)33/h2-12H,13H2,1H3,(H,27,31)(H,28,33) |
| InChIKey | CRCQATFLJSFCSJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|