C23H17BrN4O5 — CID 126361284
3-[[5-bromo-2-[(3-methylphenyl)methoxy]-3-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 126361284) has the molecular formula C23H17BrN4O5 and a molecular weight of 509.32 g/mol. Its IUPAC name is 3-[[5-bromo-2-[(3-methylphenyl)methoxy]-3-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[5-bromo-2-[(3-methylphenyl)methoxy]-3-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 126361284 |
| Molecular Formula | C23H17BrN4O5 |
| Molecular Weight | 509.32 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 3-[[5-bromo-2-[(3-methylphenyl)methoxy]-3-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | Cc1cccc(COc2c(C=Nn3c(=O)[nH]c4ccccc4c3=O)cc(Br)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17BrN4O5/c1-14-5-4-6-15(9-14)13-33-21-16(10-17(24)11-20(21)28(31)32)12-25-27-22(29)18-7-2-3-8-19(18)26-23(27)30/h2-12H,13H2,1H3,(H,26,30) |
| InChIKey | FTTJGJYAAFDNHI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|