C23H18N4O5 — CID 4280713
3-[[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 4280713) has the molecular formula C23H18N4O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is 3-[[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 4280713 |
| Molecular Formula | C23H18N4O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-[[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | Cc1cccc(COc2ccc([N+](=O)[O-])cc2C=Nn2c(=O)[nH]c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C23H18N4O5/c1-15-5-4-6-16(11-15)14-32-21-10-9-18(27(30)31)12-17(21)13-24-26-22(28)19-7-2-3-8-20(19)25-23(26)29/h2-13H,14H2,1H3,(H,25,29) |
| InChIKey | JIZXYJGTQKGDGY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|