C20H18N4O7 — CID 4264638
propan-2-yl 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetate (PubChem CID 4264638) has the molecular formula C20H18N4O7 and a molecular weight of 426.39 g/mol. Its IUPAC name is propan-2-yl 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetate.
| Compound Name | propan-2-yl 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 4264638 |
| Molecular Formula | C20H18N4O7 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | propan-2-yl 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc([N+](=O)[O-])cc1C=Nn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C20H18N4O7/c1-12(2)31-18(25)11-30-17-8-7-14(24(28)29)9-13(17)10-21-23-19(26)15-5-3-4-6-16(15)22-20(23)27/h3-10,12H,11H2,1-2H3,(H,22,27) |
| InChIKey | BHWDROAYMXMBKL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|