C19H16N4O7 — CID 3993496
ethyl 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetate (PubChem CID 3993496) has the molecular formula C19H16N4O7 and a molecular weight of 412.36 g/mol. Its IUPAC name is ethyl 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetate.
| Compound Name | ethyl 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 3993496 |
| Molecular Formula | C19H16N4O7 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | ethyl 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc([N+](=O)[O-])cc1C=Nn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C19H16N4O7/c1-2-29-17(24)11-30-16-8-7-13(23(27)28)9-12(16)10-20-22-18(25)14-5-3-4-6-15(14)21-19(22)26/h3-10H,2,11H2,1H3,(H,21,26) |
| InChIKey | JCEPKKLKIQJTAS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|