C20H20ClN3O3 — CID 3886355
3-[[5-chloro-2-(2,2-dimethylpropoxy)phenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 3886355) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 3-[[5-chloro-2-(2,2-dimethylpropoxy)phenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[5-chloro-2-(2,2-dimethylpropoxy)phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3886355 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-[[5-chloro-2-(2,2-dimethylpropoxy)phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | CC(C)(C)COc1ccc(Cl)cc1C=Nn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C20H20ClN3O3/c1-20(2,3)12-27-17-9-8-14(21)10-13(17)11-22-24-18(25)15-6-4-5-7-16(15)23-19(24)26/h4-11H,12H2,1-3H3,(H,23,26) |
| InChIKey | NJPZVHQUBCJFSD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|