C21H22N4O5 — CID 3556532
ethyl 2-[5-(dimethylamino)-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]acetate (PubChem CID 3556532) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is ethyl 2-[5-(dimethylamino)-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]acetate.
| Compound Name | ethyl 2-[5-(dimethylamino)-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3556532 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | ethyl 2-[5-(dimethylamino)-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(N(C)C)ccc1C=Nn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C21H22N4O5/c1-4-29-19(26)13-30-18-11-15(24(2)3)10-9-14(18)12-22-25-20(27)16-7-5-6-8-17(16)23-21(25)28/h5-12H,4,13H2,1-3H3,(H,23,28) |
| InChIKey | QOANIQLSSUGDLM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|