C19H16BrN3O6 — CID 4026684
2-[5-bromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxyphenoxy]acetic acid (PubChem CID 4026684) has the molecular formula C19H16BrN3O6 and a molecular weight of 462.26 g/mol. Its IUPAC name is 2-[5-bromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[5-bromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 4026684 |
| Molecular Formula | C19H16BrN3O6 |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 2-[5-bromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C19H16BrN3O6/c1-2-28-15-7-11(13(20)8-16(15)29-10-17(24)25)9-21-23-18(26)12-5-3-4-6-14(12)22-19(23)27/h3-9H,2,10H2,1H3,(H,22,27)(H,24,25) |
| InChIKey | OLULZNZPGJQOFR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|