C19H18IN3O4 — CID 5137683
3-[(3,4-diethoxy-5-iodophenyl)methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 5137683) has the molecular formula C19H18IN3O4 and a molecular weight of 479.27 g/mol. Its IUPAC name is 3-[(3,4-diethoxy-5-iodophenyl)methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(3,4-diethoxy-5-iodophenyl)methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 5137683 |
| Molecular Formula | C19H18IN3O4 |
| Molecular Weight | 479.27 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 3-[(3,4-diethoxy-5-iodophenyl)methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(I)c1OCC |
| InChI | InChI=1S/C19H18IN3O4/c1-3-26-16-10-12(9-14(20)17(16)27-4-2)11-21-23-18(24)13-7-5-6-8-15(13)22-19(23)25/h5-11H,3-4H2,1-2H3,(H,22,25) |
| InChIKey | SIBBLNJTXLAKPY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|