C23H17ClIN3O4 — CID 126351723
3-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 126351723) has the molecular formula C23H17ClIN3O4 and a molecular weight of 561.76 g/mol. Its IUPAC name is 3-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 126351723 |
| Molecular Formula | C23H17ClIN3O4 |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.00 |
| IUPAC Name | 3-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | COc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C23H17ClIN3O4/c1-31-20-11-14(10-18(25)21(20)32-13-15-6-2-4-8-17(15)24)12-26-28-22(29)16-7-3-5-9-19(16)27-23(28)30/h2-12H,13H2,1H3,(H,27,30) |
| InChIKey | NVGDGKFYKZASKA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|