C22H14BrClN4O5 — CID 126361898
3-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 126361898) has the molecular formula C22H14BrClN4O5 and a molecular weight of 529.73 g/mol. Its IUPAC name is 3-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 126361898 |
| Molecular Formula | C22H14BrClN4O5 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | 3-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1N=Cc1cc(Br)c(OCc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H14BrClN4O5/c23-16-9-13(11-25-27-21(29)15-6-2-4-8-18(15)26-22(27)30)10-19(28(31)32)20(16)33-12-14-5-1-3-7-17(14)24/h1-11H,12H2,(H,26,30) |
| InChIKey | HWFGILBLONBRAN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|