C23H14BrN5O5 — CID 126366797
2-[[2-bromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzonitrile (PubChem CID 126366797) has the molecular formula C23H14BrN5O5 and a molecular weight of 520.30 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-bromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126366797 |
| Molecular Formula | C23H14BrN5O5 |
| Molecular Weight | 520.30 g/mol |
| Exact Mass | 519.02 |
| IUPAC Name | 2-[[2-bromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Br)cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H14BrN5O5/c24-18-9-14(12-26-28-22(30)17-7-3-4-8-19(17)27-23(28)31)10-20(29(32)33)21(18)34-13-16-6-2-1-5-15(16)11-25/h1-10,12H,13H2,(H,27,31) |
| InChIKey | REPBPRKXQBVVCT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|