C24H18Br3N3O4 — CID 126362378
3-[[3-bromo-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 126362378) has the molecular formula C24H18Br3N3O4 and a molecular weight of 652.14 g/mol. Its IUPAC name is 3-[[3-bromo-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3-bromo-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 126362378 |
| Molecular Formula | C24H18Br3N3O4 |
| Molecular Weight | 652.14 g/mol |
| Exact Mass | 648.88 |
| IUPAC Name | 3-[[3-bromo-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc(Br)c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C24H18Br3N3O4/c1-2-33-21-10-14(9-19(27)22(21)34-13-15-7-8-16(25)11-18(15)26)12-28-30-23(31)17-5-3-4-6-20(17)29-24(30)32/h3-12H,2,13H2,1H3,(H,29,32) |
| InChIKey | IZPWWCKOEZZSDL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.14 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|