C17H11Br2N3O4 — CID 3932143
[2,6-dibromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenyl] acetate (PubChem CID 3932143) has the molecular formula C17H11Br2N3O4 and a molecular weight of 481.10 g/mol. Its IUPAC name is [2,6-dibromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenyl] acetate.
| Compound Name | [2,6-dibromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenyl] acetate |
|---|---|
| PubChem CID | 3932143 |
| Molecular Formula | C17H11Br2N3O4 |
| Molecular Weight | 481.10 g/mol |
| Exact Mass | 478.91 |
| IUPAC Name | [2,6-dibromo-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(Br)cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc1Br |
| InChI | InChI=1S/C17H11Br2N3O4/c1-9(23)26-15-12(18)6-10(7-13(15)19)8-20-22-16(24)11-4-2-3-5-14(11)21-17(22)25/h2-8H,1H3,(H,21,25) |
| InChIKey | CLNGDYBRUIMCGX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.10 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|