C23H17BrClN3O3 — CID 3420611
3-[[3-bromo-5-chloro-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 3420611) has the molecular formula C23H17BrClN3O3 and a molecular weight of 498.76 g/mol. Its IUPAC name is 3-[[3-bromo-5-chloro-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3-bromo-5-chloro-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3420611 |
| Molecular Formula | C23H17BrClN3O3 |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 497.01 |
| IUPAC Name | 3-[[3-bromo-5-chloro-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | Cc1cccc(COc2c(Cl)cc(C=Nn3c(=O)[nH]c4ccccc4c3=O)cc2Br)c1 |
| InChI | InChI=1S/C23H17BrClN3O3/c1-14-5-4-6-15(9-14)13-31-21-18(24)10-16(11-19(21)25)12-26-28-22(29)17-7-2-3-8-20(17)27-23(28)30/h2-12H,13H2,1H3,(H,27,30) |
| InChIKey | UOKIFJHYRYUJAV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|