C17H10Cl2N4O3 — CID 3515353
2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]acetonitrile (PubChem CID 3515353) has the molecular formula C17H10Cl2N4O3 and a molecular weight of 389.20 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]acetonitrile.
| Compound Name | 2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 3515353 |
| Molecular Formula | C17H10Cl2N4O3 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 2-[2,6-dichloro-4-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1c(Cl)cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C17H10Cl2N4O3/c18-12-7-10(8-13(19)15(12)26-6-5-20)9-21-23-16(24)11-3-1-2-4-14(11)22-17(23)25/h1-4,7-9H,6H2,(H,22,25) |
| InChIKey | SEYLYFNABYGXDR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|