C22H14ClN5O7 — CID 3472035
3-[[3-chloro-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 3472035) has the molecular formula C22H14ClN5O7 and a molecular weight of 495.84 g/mol. Its IUPAC name is 3-[[3-chloro-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[3-chloro-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3472035 |
| Molecular Formula | C22H14ClN5O7 |
| Molecular Weight | 495.84 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 3-[[3-chloro-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1N=Cc1cc(Cl)c(OCc2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H14ClN5O7/c23-17-9-14(11-24-26-21(29)16-3-1-2-4-18(16)25-22(26)30)10-19(28(33)34)20(17)35-12-13-5-7-15(8-6-13)27(31)32/h1-11H,12H2,(H,25,30) |
| InChIKey | GJBLSXCJGFTYEE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.84 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|