C25H22FN5O4 — CID 126358770
2-[5-(dimethylamino)-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-(3-fluorophenyl)acetamide (PubChem CID 126358770) has the molecular formula C25H22FN5O4 and a molecular weight of 475.48 g/mol. Its IUPAC name is 2-[5-(dimethylamino)-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[5-(dimethylamino)-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126358770 |
| Molecular Formula | C25H22FN5O4 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-[5-(dimethylamino)-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]-N-(3-fluorophenyl)acetamide |
| SMILES | CN(C)c1ccc(C=Nn2c(=O)[nH]c3ccccc3c2=O)c(OCC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C25H22FN5O4/c1-30(2)19-11-10-16(14-27-31-24(33)20-8-3-4-9-21(20)29-25(31)34)22(13-19)35-15-23(32)28-18-7-5-6-17(26)12-18/h3-14H,15H2,1-2H3,(H,28,32)(H,29,34) |
| InChIKey | YRZICBAIHPYZPX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|