C23H17N5O6 — CID 4032892
2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]-N-phenylacetamide (PubChem CID 4032892) has the molecular formula C23H17N5O6 and a molecular weight of 459.42 g/mol. Its IUPAC name is 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 4032892 |
| Molecular Formula | C23H17N5O6 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-4-nitrophenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1C=Nn1c(=O)[nH]c2ccccc2c1=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H17N5O6/c29-21(25-16-6-2-1-3-7-16)14-34-20-11-10-17(28(32)33)12-15(20)13-24-27-22(30)18-8-4-5-9-19(18)26-23(27)31/h1-13H,14H2,(H,25,29)(H,26,31) |
| InChIKey | VKYMHABBUNAAQB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|