C22H23BrN4O4 — CID 126296023
ethyl 2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]acetate (PubChem CID 126296023) has the molecular formula C22H23BrN4O4 and a molecular weight of 487.35 g/mol. Its IUPAC name is ethyl 2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]acetate.
| Compound Name | ethyl 2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 126296023 |
| Molecular Formula | C22H23BrN4O4 |
| Molecular Weight | 487.35 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | ethyl 2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(N(C)C)ccc1C=Nn1c(C)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C22H23BrN4O4/c1-5-30-21(28)13-31-20-11-17(26(3)4)8-6-15(20)12-24-27-14(2)25-19-9-7-16(23)10-18(19)22(27)29/h6-12H,5,13H2,1-4H3 |
| InChIKey | IOGRIOZHMYQEHC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|