C20H20BrN3O3 — CID 126300391
6-bromo-3-[(2,4-diethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126300391) has the molecular formula C20H20BrN3O3 and a molecular weight of 430.30 g/mol. Its IUPAC name is 6-bromo-3-[(2,4-diethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(2,4-diethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126300391 |
| Molecular Formula | C20H20BrN3O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 6-bromo-3-[(2,4-diethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one |
| SMILES | CCOc1ccc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)c(OCC)c1 |
| InChI | InChI=1S/C20H20BrN3O3/c1-4-26-16-8-6-14(19(11-16)27-5-2)12-22-24-13(3)23-18-9-7-15(21)10-17(18)20(24)25/h6-12H,4-5H2,1-3H3 |
| InChIKey | AOHAGPRSIZKDRE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|