C18H14Br3N3O2 — CID 126288143
6-bromo-3-[(3,5-dibromo-4-ethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126288143) has the molecular formula C18H14Br3N3O2 and a molecular weight of 544.04 g/mol. Its IUPAC name is 6-bromo-3-[(3,5-dibromo-4-ethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(3,5-dibromo-4-ethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126288143 |
| Molecular Formula | C18H14Br3N3O2 |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 540.86 |
| IUPAC Name | 6-bromo-3-[(3,5-dibromo-4-ethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one |
| SMILES | CCOc1c(Br)cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc1Br |
| InChI | InChI=1S/C18H14Br3N3O2/c1-3-26-17-14(20)6-11(7-15(17)21)9-22-24-10(2)23-16-5-4-12(19)8-13(16)18(24)25/h4-9H,3H2,1-2H3 |
| InChIKey | FRXVXYDGBLWYBE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|