C20H16BrI2N3O4 — CID 126308081
ethyl 2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetate (PubChem CID 126308081) has the molecular formula C20H16BrI2N3O4 and a molecular weight of 696.08 g/mol. Its IUPAC name is ethyl 2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetate |
|---|---|
| PubChem CID | 126308081 |
| Molecular Formula | C20H16BrI2N3O4 |
| Molecular Weight | 696.08 g/mol |
| Exact Mass | 694.84 |
| IUPAC Name | ethyl 2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc1I |
| InChI | InChI=1S/C20H16BrI2N3O4/c1-3-29-18(27)10-30-19-15(22)6-12(7-16(19)23)9-24-26-11(2)25-17-5-4-13(21)8-14(17)20(26)28/h4-9H,3,10H2,1-2H3 |
| InChIKey | CAQNHLORSKMUFL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.08 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|