C20H18BrI2N3O2 — CID 126312686
6-bromo-3-[[4-[(2S)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126312686) has the molecular formula C20H18BrI2N3O2 and a molecular weight of 666.10 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(2S)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(2S)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126312686 |
| Molecular Formula | C20H18BrI2N3O2 |
| Molecular Weight | 666.10 g/mol |
| Exact Mass | 664.87 |
| IUPAC Name | 6-bromo-3-[[4-[(2S)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | CC[C@H](C)Oc1c(I)cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc1I |
| InChI | InChI=1S/C20H18BrI2N3O2/c1-4-11(2)28-19-16(22)7-13(8-17(19)23)10-24-26-12(3)25-18-6-5-14(21)9-15(18)20(26)27/h5-11H,4H2,1-3H3/t11-/m0/s1 |
| InChIKey | PXYZPRUBNHYZRR-NSHDSACASA-N |
| XLogP | 5.74 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.10 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|